CAS 356570-52-0 appears in our catalog under these names: 4-Methylbenzylboronic acid, pinacol ester, 95%, 4-Methylbenzylboronic acid pinacol ester, 95-<97%, 4-Methylbenzylboronic acid pinacol ester, ≥97-<99%, 4–Methylbenzylboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-(4-methylbenzyl)-1,3,2-dioxaborolane, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 50g, 100g, 200g, 300g.
4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane (CAS 356570-52-0) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane. InChIKey: IRKUSKILEFQOJQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(4-methylphenyl)methyl]-1,3,2-dioxaborolane |
| InChIKey | IRKUSKILEFQOJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)