CAS 865360-61-8 appears in our catalog under these names: 4-(4,4-Dimethylcyclohexyl)phenylboronic acid, 95%, (4-(4,4-dimethylcyclohexyl)phenyl)boronic acid, ≥95%, ≥95%, 4-(4,4-Dimethylcyclohexyl)phenylboronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[4-(4,4-dimethylcyclohexyl)phenyl]boronic acid (CAS 865360-61-8) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: [4-(4,4-dimethylcyclohexyl)phenyl]boronic acid. InChIKey: KRMIWWSLZCKLRQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | [4-(4,4-dimethylcyclohexyl)phenyl]boronic acid |
| InChIKey | KRMIWWSLZCKLRQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCC(CC2)(C)C)(O)O |
Computed by PubChem (NCBI)