CAS 165904-22-3 appears in our catalog under these names: 2-Phenylethylboronic acid, pinacol ester, 96%, 2-Phenylethyl-1-boronic acid pinacol ester, 99% , 4,4,5,5-Tetramethyl-2-phenethyl-1,3,2-dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-phenethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane (CAS 165904-22-3) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane. InChIKey: LVLQNRWCBBIVHR-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane |
| InChIKey | LVLQNRWCBBIVHR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2=CC=CC=C2 |
Computed by PubChem (NCBI)