CAS 253342-48-2 appears in our catalog under these names: 4,4,5,5–Tetramethyl–2–(m–tolyl)–1,3,2–dioxaborolane, 4,4,5,5-Tetramethyl-2-(m-tolyl)-1,3,2-dioxaborolane, >98.0%(GC)(T), 4,4,5,5-Tetramethyl-2-(m-tolyl)-1,3,2-dioxaborolane, 98%, 98%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
4,4,5,5-tetramethyl-2-(3-methylphenyl)-1,3,2-dioxaborolane (CAS 253342-48-2) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 218.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylphenyl)-1,3,2-dioxaborolane. InChIKey: XDKYCZBGHPGKEP-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylphenyl)-1,3,2-dioxaborolane |
| InChIKey | XDKYCZBGHPGKEP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C |
Computed by PubChem (NCBI)