Products 1092060-77-9
CAS 1092060-77-9 appears in our catalog under these names: 4,4,6-Trimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane, 95%, 4,4,6-Trimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 1g, 5g, 250mg, 25g, 50g, 100g, 200g, 300g.
4,4,6-trimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane (CAS 1092060-77-9) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 218.10 g/mol. IUPAC name: 4,4,6-trimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane. InChIKey: IYTPJHRQJDVFDF-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 4,4,6-trimethyl-2-(4-methylphenyl)-1,3,2-dioxaborinane |
| InChIKey | IYTPJHRQJDVFDF-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)