Products 1370412-35-3
CAS 1370412-35-3 appears in our catalog under these names: 2-(4-(tert-Butyl)phenyl)-1,3,2-dioxaborinane, 98%, 98%, 2-(4-(tert-Butyl)phenyl)-1,3,2-dioxaborinane, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g.
2-(4-tert-butylphenyl)-1,3,2-dioxaborinane (CAS 1370412-35-3) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 218.10 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-1,3,2-dioxaborinane. InChIKey: HZBDNJVQDZVZBJ-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-1,3,2-dioxaborinane |
| InChIKey | HZBDNJVQDZVZBJ-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)