Products 2235417-07-7
CAS 2235417-07-7 is the registry number for p-Tolylpinacolboronate-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,4,5,5-tetramethyl-2-[4-(trideuteriomethyl)phenyl]-1,3,2-dioxaborolane (CAS 2235417-07-7) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 221.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(trideuteriomethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: GKSSEDDAXXEPCP-FIBGUPNXSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(trideuteriomethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GKSSEDDAXXEPCP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)B2OC(C(O2)(C)C)(C)C |
Computed by PubChem (NCBI)