CAS 2225152-93-0 is the registry number for 3–Cyclopropyl–5–(sec–butyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(3-butan-2-yl-5-cyclopropylphenyl)boronic acid (CAS 2225152-93-0) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 218.10 g/mol. IUPAC name: (3-butan-2-yl-5-cyclopropylphenyl)boronic acid. InChIKey: RXJXCSMUVIJZGT-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | (3-butan-2-yl-5-cyclopropylphenyl)boronic acid |
| InChIKey | RXJXCSMUVIJZGT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)CC)C2CC2)(O)O |
Computed by PubChem (NCBI)