CAS 2225169-44-6 is the registry number for 3–(Cyclopropyl)–5–(iso–butyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-cyclopropyl-5-(2-methylpropyl)phenyl]boronic acid (CAS 2225169-44-6) is a chemical compound with the molecular formula C13H19BO2 and a molecular weight of 218.10 g/mol. IUPAC name: [3-cyclopropyl-5-(2-methylpropyl)phenyl]boronic acid. InChIKey: APXVSYMCUCTCBP-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2 |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | [3-cyclopropyl-5-(2-methylpropyl)phenyl]boronic acid |
| InChIKey | APXVSYMCUCTCBP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C2CC2)CC(C)C)(O)O |
Computed by PubChem (NCBI)