cas: 62679-61-2 — see every product listed under this CAS number, including other names
4,4-Difluoro-1-phenyl-1,3-butanedione (CAS 62679-61-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005927-1G |
| cas | 62679-61-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 862.21 Pln | |
| Fluorochem | 25g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
4,4-difluoro-1-phenylbutane-1,3-dione (CAS 62679-61-2) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 4,4-difluoro-1-phenylbutane-1,3-dione. InChIKey: JTIPWONXTZMDOK-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 4,4-difluoro-1-phenylbutane-1,3-dione |
| InChIKey | JTIPWONXTZMDOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)