cas: 35179-55-6 — see every product listed under this CAS number, including other names
4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazole, 98% (CAS 35179-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020078-250MG |
| cas | 35179-55-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1752.53 Pln | |
| Fluorochem | 10g | 3288.44 Pln | |
| Fluorochem | 25g | 6360.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole (CAS 35179-55-6) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole. InChIKey: KTULFINKQNWXNY-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole |
| InChIKey | KTULFINKQNWXNY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)