CAS 890005-22-8 is the registry number for 4,5,6,7-Tetrahydro-3-(trifluoromethyl)-2h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole (CAS 890005-22-8) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole. InChIKey: KTULFINKQNWXNY-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole |
| InChIKey | KTULFINKQNWXNY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)