CAS 473837-10-4 is the registry number for 4,5-Dichloronicotinic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
4,5-dichloropyridine-3-carboxylic acid (CAS 473837-10-4) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 4,5-dichloropyridine-3-carboxylic acid. InChIKey: FLHXJEWJASHMBK-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 4,5-dichloropyridine-3-carboxylic acid |
| InChIKey | FLHXJEWJASHMBK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)