cas: 628732-11-6 — see every product listed under this CAS number, including other names
4,5-Difluoro-2,3-dihydro-1H-inden-1-one, 98% (CAS 628732-11-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209476-1G |
| cas | 628732-11-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 950.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,5-difluoro-2,3-dihydroinden-1-one (CAS 628732-11-6) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 4,5-difluoro-2,3-dihydroinden-1-one. InChIKey: FHKJIIXGCLYMCN-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 4,5-difluoro-2,3-dihydroinden-1-one |
| InChIKey | FHKJIIXGCLYMCN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)F)F |
Computed by PubChem (NCBI)