4，5-Difluoro-2，3-dihydro-1H-inden-1-one, 97%, 97%
cas: 628732-11-6 — see every product listed under this CAS number, including other names
4，5-Difluoro-2，3-dihydro-1H-inden-1-one, 97%, 97% (CAS 628732-11-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECSP-100mg |
| cas | 628732-11-6 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 587.60 Pln | |
| Chemat | 25g | 1302.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,5-difluoro-2,3-dihydroinden-1-one (CAS 628732-11-6) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 4,5-difluoro-2,3-dihydroinden-1-one. InChIKey: FHKJIIXGCLYMCN-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 4,5-difluoro-2,3-dihydroinden-1-one |
| InChIKey | FHKJIIXGCLYMCN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)F)F |
Computed by PubChem (NCBI)
Synonyms:
4,5-Difluoro-2,3-dihydro-1H-inden-1-one, 4,5-Difluoroindan-1-one, 4,5-difluoro-2,3-dihydroinden-1-one, 4,5-Difluoro-indan-1-one, 1H-Inden-1-one,4,5-difluoro-2,3-dihydro-, FHKJIIXGCLYMCN-UHFFFAOYSA-N, 45-Difluoro-23-dihydro-1H-inden-1-one, 1H-Inden-1-one,4,5-difluoro-2,3-dihydro, 4,5-Difluoro-1-indanone;4,5-Difluoroindan-1-one