cas: 78056-39-0 — see every product listed under this CAS number, including other names
4,5-Difluoro-2-nitroaniline, 98%, 98% (CAS 78056-39-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144V0-5g |
| cas | 78056-39-0 |
| size | 5g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 275.60 Pln | |
| Chemat | 1kg | 2138.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,5-difluoro-2-nitroaniline (CAS 78056-39-0) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 4,5-difluoro-2-nitroaniline. InChIKey: WDMCABATCGQAKK-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 4,5-difluoro-2-nitroaniline |
| InChIKey | WDMCABATCGQAKK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)