cas: 88912-25-8 — see every product listed under this CAS number, including other names
4,6-Dichloropicolinic acid, 95% (CAS 88912-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049501-1G |
| cas | 88912-25-8 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1242.29 Pln | |
| Fluorochem | 500g | 4121.48 Pln | |
| Fluorochem | 1kg | 7989.91 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
4,6-dichloropyridine-2-carboxylic acid (CAS 88912-25-8) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 4,6-dichloropyridine-2-carboxylic acid. InChIKey: AYYUSDKNXRPJBH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 4,6-dichloropyridine-2-carboxylic acid |
| InChIKey | AYYUSDKNXRPJBH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)