cas: 684220-30-2 — see every product listed under this CAS number, including other names
4,6-Dichloropyrimidine-2-carboxylic acid, 97%, 97% (CAS 684220-30-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147TW-50mg |
| cas | 684220-30-2 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 429.20 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 2171.60 Pln | |
| Chemat | 5g | 8181.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-dichloropyrimidine-2-carboxylic acid (CAS 684220-30-2) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 4,6-dichloropyrimidine-2-carboxylic acid. InChIKey: XTPRJRYOVQDBID-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 4,6-dichloropyrimidine-2-carboxylic acid |
| InChIKey | XTPRJRYOVQDBID-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)