4,6-Dichloropyrimidine-5-carboxylic acid, 95%
cas: 87600-98-4 — see every product listed under this CAS number, including other names
4,6-Dichloropyrimidine-5-carboxylic acid, 95% (CAS 87600-98-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A183664-1g |
| cas | 87600-98-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 370.38 Pln | |
| Ambeed | 100g | 1171.38 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1211.05 Pln | |
| Fluorochem | 500g | 5699.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4,6-dichloropyrimidine-5-carboxylic acid (CAS 87600-98-4) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 4,6-dichloropyrimidine-5-carboxylic acid. InChIKey: KGBLYFGHJNGQBK-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 4,6-dichloropyrimidine-5-carboxylic acid |
| InChIKey | KGBLYFGHJNGQBK-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)