4,6-Diphenyl-1,3,5-triazin-2-amine, 97%
cas: 5418-07-5 — see every product listed under this CAS number, including other names
4,6-Diphenyl-1,3,5-triazin-2-amine, 97% (CAS 5418-07-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJ2J-100mg |
| cas | 5418-07-5 |
| size | 100mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 880.40 Pln | |
| Chemat | 5g | 3424.40 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 398.84 Pln | |
| Fluorochem | 1g | 898.66 Pln | |
| Fluorochem | 5g | 4173.55 Pln | |
| Fluorochem | 10g | 7458.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-diphenyl-1,3,5-triazin-2-amine (CAS 5418-07-5) is a chemical compound with the molecular formula C15H12N4 and a molecular weight of 248.28 g/mol. IUPAC name: 4,6-diphenyl-1,3,5-triazin-2-amine. InChIKey: HWLRYMYJGAGIME-UHFFFAOYSA-N.
| Molecular formula | C15H12N4 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 4,6-diphenyl-1,3,5-triazin-2-amine |
| InChIKey | HWLRYMYJGAGIME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)