4,7-Dibromo-2,1,3-benzothiadiazole, 98%
cas: 15155-41-6 — see every product listed under this CAS number, including other names
4,7-Dibromo-2,1,3-benzothiadiazole, 98% (CAS 15155-41-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A171470-1g |
| cas | 15155-41-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 153.44 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 704.12 Pln | |
| Ambeed | 500g | 2528.62 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 219.95 Pln | |
| BLDpharm | 25g | 275.48 Pln | |
| BLDpharm | 100g | 753.09 Pln | |
| BLDpharm | 500g | 3335.52 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4,7-dibromo-2,1,3-benzothiadiazole (CAS 15155-41-6) is a chemical compound with the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. IUPAC name: 4,7-dibromo-2,1,3-benzothiadiazole. InChIKey: FEOWHLLJXAECMU-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S |
|---|---|
| Molecular weight | 293.97 g/mol |
| IUPAC name | 4,7-dibromo-2,1,3-benzothiadiazole |
| InChIKey | FEOWHLLJXAECMU-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NSN=C2C(=C1)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
4,7-Dibromo-2,1,3-benzothiadiazole, 4,7-dibromobenzo[c][1,2,5]thiadiazole, 4,7-Dibromobenzo[c]-1,2,5-thiadiazole, 2,1,3-Benzothiadiazole, 4,7-dibromo-, 4,7-Dibromobenzo-2,1,3-thiadiazole, Dibromo BTD, orb2939940, 4,7-dibromobenzo[1,2,5]thiadiazole, 4,7-dibromobenzo[2,1,3]thiadiazole, 4,7-dibromo -2,1,3-benzothiadiazole