CAS 1643854-33-4 is the registry number for 3,6-Dibromoisothiazolo(4,3-b)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3,6-dibromo-[1,2]thiazolo[4,3-b]pyridine (CAS 1643854-33-4) is a chemical compound with the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. IUPAC name: 3,6-dibromo-[1,2]thiazolo[4,3-b]pyridine. InChIKey: XFINWAKFJGTYGZ-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S |
|---|---|
| Molecular weight | 293.97 g/mol |
| IUPAC name | 3,6-dibromo-[1,2]thiazolo[4,3-b]pyridine |
| InChIKey | XFINWAKFJGTYGZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C(SN=C21)Br)Br |
Computed by PubChem (NCBI)