CAS 1440428-02-3 is the registry number for 2,5-Dibromo-[1,3]thiazolo[5,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2,5-dibromo-[1,3]thiazolo[5,4-b]pyridine (CAS 1440428-02-3) is a chemical compound with the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. IUPAC name: 2,5-dibromo-[1,3]thiazolo[5,4-b]pyridine. InChIKey: RQNMVJKYAZGOPI-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S |
|---|---|
| Molecular weight | 293.97 g/mol |
| IUPAC name | 2,5-dibromo-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | RQNMVJKYAZGOPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(S2)Br)Br |
Computed by PubChem (NCBI)