CAS 54558-26-8 is the registry number for 4,6-Dibromobenzo[c][1,2,5]thiadiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,6-dibromo-2,1,3-benzothiadiazole (CAS 54558-26-8) is a chemical compound with the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. IUPAC name: 4,6-dibromo-2,1,3-benzothiadiazole. InChIKey: LLKRMESEOPNWJV-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S |
|---|---|
| Molecular weight | 293.97 g/mol |
| IUPAC name | 4,6-dibromo-2,1,3-benzothiadiazole |
| InChIKey | LLKRMESEOPNWJV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NSN=C21)Br)Br |
Computed by PubChem (NCBI)