Products 1841081-51-3
CAS 1841081-51-3 is the registry number for 5，6–Dibromothieno(2，3–d)pyrimidine. Offered by: GLPBio. Available pack sizes: 250mg.
5,6-dibromothieno[2,3-d]pyrimidine (CAS 1841081-51-3) is a chemical compound with the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. IUPAC name: 5,6-dibromothieno[2,3-d]pyrimidine. InChIKey: PJDPHTOBNOIZAL-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S |
|---|---|
| Molecular weight | 293.97 g/mol |
| IUPAC name | 5,6-dibromothieno[2,3-d]pyrimidine |
| InChIKey | PJDPHTOBNOIZAL-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(SC2=NC=N1)Br)Br |
Computed by PubChem (NCBI)