CAS 18392-81-9 appears in our catalog under these names: 5,6-Dibromo-2,1,3-benzothiadiazole, 96%, 5,6–Dibromo–2,1,3–benzothiadiazole, 5,6-Dibromo-2,1,3-benzothiadiazole, >98.0%(GC), 5,6-Dibromobenzo[c][1,2,5]thiadiazole 97%, 5,6-Dibromobenzo[c][1,2,5]thiadiazole, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 250mg, 100mg.
5,6-dibromo-2,1,3-benzothiadiazole (CAS 18392-81-9) is a chemical compound with the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. IUPAC name: 5,6-dibromo-2,1,3-benzothiadiazole. InChIKey: XIDGOHYQUCNHTL-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S |
|---|---|
| Molecular weight | 293.97 g/mol |
| IUPAC name | 5,6-dibromo-2,1,3-benzothiadiazole |
| InChIKey | XIDGOHYQUCNHTL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NSN=C21)Br)Br |
Computed by PubChem (NCBI)