cas: 50593-69-6 — see every product listed under this CAS number, including other names
4,7-Dichloro-2-methylquinoline, 97% (CAS 50593-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321915-100MG |
| cas | 50593-69-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 1476.58 Pln | |
| Fluorochem | 5g | 5324.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,7-dichloro-2-methylquinoline (CAS 50593-69-6) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 4,7-dichloro-2-methylquinoline. InChIKey: QTYCALFKBCOYLW-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 4,7-dichloro-2-methylquinoline |
| InChIKey | QTYCALFKBCOYLW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=CC2=N1)Cl)Cl |
Computed by PubChem (NCBI)