4,7-Difluoroindan-1-one, 98%
cas: 130408-16-1 — see every product listed under this CAS number, including other names
4,7-Difluoroindan-1-one, 98% (CAS 130408-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111UDC-100mg |
| cas | 130408-16-1 |
| size | 100mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 10g | 914.00 Pln | |
| Chemat | 25g | 1130.00 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 804.94 Pln | |
| Fluorochem | 25g | 2934.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,7-difluoro-2,3-dihydroinden-1-one (CAS 130408-16-1) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 4,7-difluoro-2,3-dihydroinden-1-one. InChIKey: KMWBFTTYYGUTNW-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 4,7-difluoro-2,3-dihydroinden-1-one |
| InChIKey | KMWBFTTYYGUTNW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)F)F |
Computed by PubChem (NCBI)