CAS 3248-05-3 appears in our catalog under these names: 4,7-Dimethyl-1,10-phenanthroline, 97%, 4,7-Dimethyl-1,10-phenanthroline, 98% , 4,7-Dimethyl-1,10-phenanthroline, >98.0%(T), 4,7-Dimethyl-1,10-phenanthroline, 98%, 98%, 4,7-Dimethyl-1,10-phenanthroline, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Chemat, Ambeed. Available pack sizes: 1g, 10g, 25g, 5g, 0.25g, 100mg, 250mg, 15g.
4,7-dimethyl-1,10-phenanthroline (CAS 3248-05-3) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4,7-dimethyl-1,10-phenanthroline. InChIKey: JIVLDFFWTQYGSR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4,7-dimethyl-1,10-phenanthroline |
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C=CN=C3C2=NC=C1)C |
Computed by PubChem (NCBI)