cas: 3248-05-3 — see every product listed under this CAS number, including other names
4,7-Dimethyl-1,10-phenanthroline 98% (CAS 3248-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158709-100g |
| cas | 3248-05-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 14437.94 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1199.19 Pln | |
| Ambeed | 10g | 2044.69 Pln | |
| Ambeed | 25g | 4558.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158709 |
4,7-dimethyl-1,10-phenanthroline (CAS 3248-05-3) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4,7-dimethyl-1,10-phenanthroline. InChIKey: JIVLDFFWTQYGSR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4,7-dimethyl-1,10-phenanthroline |
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C=CN=C3C2=NC=C1)C |
Computed by PubChem (NCBI)