cas: 309964-23-6 — see every product listed under this CAS number, including other names
4–(4–Formyl–3–methoxyphenoxy)–butyric acid (CAS 309964-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD13642-1g |
| cas | 309964-23-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 564.28 Pln | |
| GLPBio | 25g | 2422.43 Pln | |
| GLPBio | 5g | 938.72 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-formyl-3-methoxyphenoxy)butanoic acid (CAS 309964-23-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(4-formyl-3-methoxyphenoxy)butanoic acid. InChIKey: RHQAFYIBBWZTOI-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(4-formyl-3-methoxyphenoxy)butanoic acid |
| InChIKey | RHQAFYIBBWZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OCCCC(=O)O)C=O |
Computed by PubChem (NCBI)