cas: 309964-23-6 — see every product listed under this CAS number, including other names
4-(4'-Formyl-3'-methoxy)phenoxy butyric acid, 96% (CAS 309964-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011747-1G |
| cas | 309964-23-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 10g | 659.16 Pln | |
| Fluorochem | 25g | 1320.39 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-formyl-3-methoxyphenoxy)butanoic acid (CAS 309964-23-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(4-formyl-3-methoxyphenoxy)butanoic acid. InChIKey: RHQAFYIBBWZTOI-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(4-formyl-3-methoxyphenoxy)butanoic acid |
| InChIKey | RHQAFYIBBWZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OCCCC(=O)O)C=O |
Computed by PubChem (NCBI)