cas: 309964-23-6 — see every product listed under this CAS number, including other names
4-(4-Formyl-3-methoxyphenoxy)butanoic acid, 98%, 98% (CAS 309964-23-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142VU-250mg |
| cas | 309964-23-6 |
| size | 250mg |
| availability | 151g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 510.80 Pln | |
| Chemat | 25g | 1000.40 Pln | |
| Chemat | 50g | 1614.80 Pln | |
| Chemat | 100g | 2570.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-formyl-3-methoxyphenoxy)butanoic acid (CAS 309964-23-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(4-formyl-3-methoxyphenoxy)butanoic acid. InChIKey: RHQAFYIBBWZTOI-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(4-formyl-3-methoxyphenoxy)butanoic acid |
| InChIKey | RHQAFYIBBWZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OCCCC(=O)O)C=O |
Computed by PubChem (NCBI)