cas: 16588-69-5 — see every product listed under this CAS number, including other names
4–Chloro–2–(trifluoromethyl)phenyl isocyanate (CAS 16588-69-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD06388-100g |
| cas | 16588-69-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 4753.32 Pln | |
| GLPBio | 1g | 559.60 Pln | |
| GLPBio | 25g | 2581.57 Pln | |
| GLPBio | 5g | 957.44 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-chloro-1-isocyanato-2-(trifluoromethyl)benzene (CAS 16588-69-5) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 4-chloro-1-isocyanato-2-(trifluoromethyl)benzene. InChIKey: SBDPJLJFODHSFF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 4-chloro-1-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | SBDPJLJFODHSFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)N=C=O |
Computed by PubChem (NCBI)