cas: 1710-98-1 — see every product listed under this CAS number, including other names
4–tert–Butylbenzoyl chloride (CAS 1710-98-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g, 500g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD22131-100g |
| cas | 1710-98-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 840.43 Pln | |
| GLPBio | 25g | 559.60 Pln | |
| GLPBio | 500g | 2183.73 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-tert-butylbenzoyl chloride (CAS 1710-98-1) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 4-tert-butylbenzoyl chloride. InChIKey: WNLMYNASWOULQY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 4-tert-butylbenzoyl chloride |
| InChIKey | WNLMYNASWOULQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)