cas: 50670-50-3 — see every product listed under this CAS number, including other names
4′-Methyl[1,1′-biphenyl]-4-carbonitrile, 97%, 97% (CAS 50670-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L9Y-1g |
| cas | 50670-50-3 |
| size | 1g |
| availability | 49g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 794.00 Pln | |
| Chemat | 250mg | 102.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4-methylphenyl)benzonitrile (CAS 50670-50-3) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 4-(4-methylphenyl)benzonitrile. InChIKey: QIBWMVSMTSYUSK-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-(4-methylphenyl)benzonitrile |
| InChIKey | QIBWMVSMTSYUSK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)