cas: 216670-47-2 — see every product listed under this CAS number, including other names
4-(1-Pyrrolidinyl)aniline Hydrochloride, 98%, 98% (CAS 216670-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JYC-100mg |
| cas | 216670-47-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 10g | 1326.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-pyrrolidin-1-ylaniline;hydrochloride (CAS 216670-47-2) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 4-pyrrolidin-1-ylaniline;hydrochloride. InChIKey: CKZKSFMNJXRVNG-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylaniline;hydrochloride |
| InChIKey | CKZKSFMNJXRVNG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)