cas: 216670-47-2 — see every product listed under this CAS number, including other names
4-(Pyrrolidin-1-yl)aniline hydrochloride, 98% (CAS 216670-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447369-1G |
| cas | 216670-47-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 10g | 1039.24 Pln | |
| Fluorochem | 25g | 2512.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-pyrrolidin-1-ylaniline;hydrochloride (CAS 216670-47-2) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 4-pyrrolidin-1-ylaniline;hydrochloride. InChIKey: CKZKSFMNJXRVNG-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylaniline;hydrochloride |
| InChIKey | CKZKSFMNJXRVNG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)