cas: 23351-05-5 — see every product listed under this CAS number, including other names
4-(1H-Pyrrol-1-yl)benzaldehyde, 97%, 97% (CAS 23351-05-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113MXH-100mg |
| cas | 23351-05-5 |
| size | 100mg |
| availability | 41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 592.40 Pln | |
| Chemat | 25g | 1235.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-pyrrol-1-ylbenzaldehyde (CAS 23351-05-5) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 4-pyrrol-1-ylbenzaldehyde. InChIKey: VMNADOXDGZJTBJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 4-pyrrol-1-ylbenzaldehyde |
| InChIKey | VMNADOXDGZJTBJ-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)