Products 1889432-53-4
CAS 1889432-53-4 appears in our catalog under these names: 4–(2，2–difluorocyclopropyl)benzoic acid, 4-(2,2-Difluorocyclopropyl)benzoic acid, 4-(2,2-DIFLUOROCYCLOPROPYL)BENZOIC ACID, ≥95%, 4-(2,2-Difluorocyclopropyl)benzoic Acid, ≥95%, ≥95%. Offered by: GLPBio, Biosynth, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
4-(2,2-difluorocyclopropyl)benzoic acid (CAS 1889432-53-4) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 4-(2,2-difluorocyclopropyl)benzoic acid. InChIKey: XYFDFORPHCGFCM-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 4-(2,2-difluorocyclopropyl)benzoic acid |
| InChIKey | XYFDFORPHCGFCM-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)