cas: 101967-39-9 — see every product listed under this CAS number, including other names
4-(2,5-Dimethylphenyl)thiazol-2-amine 97% (CAS 101967-39-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A852831-250mg |
| cas | 101967-39-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1366.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A852831 |
4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine (CAS 101967-39-9) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: XMAIQILQRXZWMI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | XMAIQILQRXZWMI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)