cas: 101967-39-9 — see every product listed under this CAS number, including other names
4-(2,5-Dimethylphenyl)thiazol-2-amine, 97%, 97% (CAS 101967-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111752-100mg |
| cas | 101967-39-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 500mg | 227.60 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1053.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine (CAS 101967-39-9) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: XMAIQILQRXZWMI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | XMAIQILQRXZWMI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)