CAS 1093641-93-0 appears in our catalog under these names: 4-(2,6-Difluorophenoxy)benzoic acid, 95%, 95%, 4-(2,6-Difluorophenoxy)benzoic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(2,6-difluorophenoxy)benzoic acid (CAS 1093641-93-0) is a chemical compound with the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. IUPAC name: 4-(2,6-difluorophenoxy)benzoic acid. InChIKey: OHFPXRGHPVCPPQ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O3 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 4-(2,6-difluorophenoxy)benzoic acid |
| InChIKey | OHFPXRGHPVCPPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)