Products 1261981-84-3
CAS 1261981-84-3 is the registry number for 4-(4-Carboxy-3-fluorophenyl)-2-fluorophenol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-fluoro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid (CAS 1261981-84-3) is a chemical compound with the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. IUPAC name: 2-fluoro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid. InChIKey: WAOJTEBFVYXERU-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O3 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 2-fluoro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid |
| InChIKey | WAOJTEBFVYXERU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)O)F)F)C(=O)O |
Computed by PubChem (NCBI)