CAS 1286107-99-0 appears in our catalog under these names: Diflunisal-d3, Diflunisal–d3, Diflunisal-d3, 99.71%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 2.5 mg.
2,4,5-trideuterio-3-(2,4-difluorophenyl)-6-hydroxybenzoic acid (CAS 1286107-99-0) is a chemical compound with the molecular formula C13H8F2O3 and a molecular weight of 253.21 g/mol. IUPAC name: 2,4,5-trideuterio-3-(2,4-difluorophenyl)-6-hydroxybenzoic acid. InChIKey: HUPFGZXOMWLGNK-NHPOFCFZSA-N.
| Molecular formula | C13H8F2O3 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 2,4,5-trideuterio-3-(2,4-difluorophenyl)-6-hydroxybenzoic acid |
| InChIKey | HUPFGZXOMWLGNK-NHPOFCFZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C=C(C=C2)F)F)[2H])C(=O)O)O)[2H] |
Computed by PubChem (NCBI)