CAS 748183-47-3 appears in our catalog under these names: 4-(2,4-Difluorophenoxy)benzoic acid, 4-(2,4-difluorophenoxy)benzoic acid, 95%, 95%, 4-(2,4-Difluorophenoxy)benzoic acid, 99.65%, 4-(2,4-Difluorophenoxy)benzoic acid, 98%, 4-(2,4-Difluorophenoxy)benzoic acid, 95%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g, 250 mg, 500 mg, 100 mg.
4-(2,4-difluorophenoxy)benzoic acid (CAS 748183-47-3) is a chemical compound with the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. IUPAC name: 4-(2,4-difluorophenoxy)benzoic acid. InChIKey: GBNIIFZBFSZDQA-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O3 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 4-(2,4-difluorophenoxy)benzoic acid |
| InChIKey | GBNIIFZBFSZDQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)