Products 1153088-42-6
CAS 1153088-42-6 appears in our catalog under these names: 4-(3,4-Difluorophenoxy)benzoic acid, 4-(3,4-Difluorophenoxy)benzoic acid 95%, 4-(3,4-Difluorophenoxy)benzoic acid, 95%, 95%, 4-(3,4-Difluorophenoxy)benzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
4-(3,4-difluorophenoxy)benzoic acid (CAS 1153088-42-6) is a chemical compound with the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. IUPAC name: 4-(3,4-difluorophenoxy)benzoic acid. InChIKey: DRSHBFVQGWCVMK-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O3 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 4-(3,4-difluorophenoxy)benzoic acid |
| InChIKey | DRSHBFVQGWCVMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)