CAS 1258635-47-0 is the registry number for Diflunisal Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-difluorophenyl)-2-hydroxybenzoic acid (CAS 1258635-47-0) is a chemical compound with the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-2-hydroxybenzoic acid. InChIKey: GOAWZJPRUDKMRF-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O3 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-2-hydroxybenzoic acid |
| InChIKey | GOAWZJPRUDKMRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)