cas: 364070-34-8 — see every product listed under this CAS number, including other names
4-(2,6-Dimethylphenyl)benzoic acid, 95%, 95% (CAS 364070-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118A3U-100mg |
| cas | 364070-34-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1749.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2,6-dimethylphenyl)benzoic acid (CAS 364070-34-8) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 4-(2,6-dimethylphenyl)benzoic acid. InChIKey: LDNLTMRRJNZNRE-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4-(2,6-dimethylphenyl)benzoic acid |
| InChIKey | LDNLTMRRJNZNRE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)