CAS 128460-74-2 appears in our catalog under these names: Methyl 3'-methyl[1,1'-biphenyl]-3-carboxylate, 95%, METHYL 3'-METHYLBIPHENYL-3-CARBOXYLATE, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Methyl 3-(3-methylphenyl)benzoate (CAS 128460-74-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: methyl 3-(3-methylphenyl)benzoate. InChIKey: CVGLGEBUFGMUDD-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | methyl 3-(3-methylphenyl)benzoate |
| InChIKey | CVGLGEBUFGMUDD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)