cas: 168892-66-8 — see every product listed under this CAS number, including other names
4-(2-((tert-Butoxycarbonyl)amino)ethoxy)benzoic acid 97% (CAS 168892-66-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A592713-100mg |
| cas | 168892-66-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A592713 |
4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid (CAS 168892-66-8) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid. InChIKey: COIQSXDNBXSYMY-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
| InChIKey | COIQSXDNBXSYMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)